C21H21ClN4O5S — CID 2081616
(2S)-N-(2-chloro-5-nitrophenyl)-2-[3-[(2R)-1-methoxypropan-2-yl]-4-oxoquinazolin-2-yl]sulfanylpropanamide (PubChem CID 2081616) has the molecular formula C21H21ClN4O5S and a molecular weight of 476.94 g/mol. Its IUPAC name is (2S)-N-(2-chloro-5-nitrophenyl)-2-[3-[(2R)-1-methoxypropan-2-yl]-4-oxoquinazolin-2-yl]sulfanylpropanamide.
| Compound Name | (2S)-N-(2-chloro-5-nitrophenyl)-2-[3-[(2R)-1-methoxypropan-2-yl]-4-oxoquinazolin-2-yl]sulfanylpropanamide |
|---|---|
| PubChem CID | 2081616 |
| Molecular Formula | C21H21ClN4O5S |
| Molecular Weight | 476.94 g/mol |
| Exact Mass | 476.09 |
| IUPAC Name | (2S)-N-(2-chloro-5-nitrophenyl)-2-[3-[(2R)-1-methoxypropan-2-yl]-4-oxoquinazolin-2-yl]sulfanylpropanamide |
| SMILES | COC[C@@H](C)n1c(S[C@@H](C)C(=O)Nc2cc([N+](=O)[O-])ccc2Cl)nc2ccccc2c1=O |
| InChI | InChI=1S/C21H21ClN4O5S/c1-12(11-31-3)25-20(28)15-6-4-5-7-17(15)24-21(25)32-13(2)19(27)23-18-10-14(26(29)30)8-9-16(18)22/h4-10,12-13H,11H2,1-3H3,(H,23,27)/t12-,13+/m1/s1 |
| InChIKey | CFAWBFPDKNUHFH-OLZOCXBDSA-N |
| XLogP | 4.28 |
| TPSA | 116.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.94 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|