C22H17ClN4O5S — CID 46787480
N-(2-chloro-4-nitrophenyl)-2-[3-(furan-2-ylmethyl)-4-oxoquinazolin-2-yl]sulfanylpropanamide (PubChem CID 46787480) has the molecular formula C22H17ClN4O5S and a molecular weight of 484.92 g/mol. Its IUPAC name is N-(2-chloro-4-nitrophenyl)-2-[3-(furan-2-ylmethyl)-4-oxoquinazolin-2-yl]sulfanylpropanamide.
| Compound Name | N-(2-chloro-4-nitrophenyl)-2-[3-(furan-2-ylmethyl)-4-oxoquinazolin-2-yl]sulfanylpropanamide |
|---|---|
| PubChem CID | 46787480 |
| Molecular Formula | C22H17ClN4O5S |
| Molecular Weight | 484.92 g/mol |
| Exact Mass | 484.06 |
| IUPAC Name | N-(2-chloro-4-nitrophenyl)-2-[3-(furan-2-ylmethyl)-4-oxoquinazolin-2-yl]sulfanylpropanamide |
| SMILES | CC(Sc1nc2ccccc2c(=O)n1Cc1ccco1)C(=O)Nc1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C22H17ClN4O5S/c1-13(20(28)24-19-9-8-14(27(30)31)11-17(19)23)33-22-25-18-7-3-2-6-16(18)21(29)26(22)12-15-5-4-10-32-15/h2-11,13H,12H2,1H3,(H,24,28) |
| InChIKey | KVNKKDCSBQUGAW-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 120.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.92 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|