C25H31N3O4S — CID 46619223
N-(3,4-dimethoxyphenyl)-2-(3-hexyl-4-oxoquinazolin-2-yl)sulfanylpropanamide (PubChem CID 46619223) has the molecular formula C25H31N3O4S and a molecular weight of 469.61 g/mol. Its IUPAC name is N-(3,4-dimethoxyphenyl)-2-(3-hexyl-4-oxoquinazolin-2-yl)sulfanylpropanamide.
| Compound Name | N-(3,4-dimethoxyphenyl)-2-(3-hexyl-4-oxoquinazolin-2-yl)sulfanylpropanamide |
|---|---|
| PubChem CID | 46619223 |
| Molecular Formula | C25H31N3O4S |
| Molecular Weight | 469.61 g/mol |
| Exact Mass | 469.20 |
| IUPAC Name | N-(3,4-dimethoxyphenyl)-2-(3-hexyl-4-oxoquinazolin-2-yl)sulfanylpropanamide |
| SMILES | CCCCCCn1c(SC(C)C(=O)Nc2ccc(OC)c(OC)c2)nc2ccccc2c1=O |
| InChI | InChI=1S/C25H31N3O4S/c1-5-6-7-10-15-28-24(30)19-11-8-9-12-20(19)27-25(28)33-17(2)23(29)26-18-13-14-21(31-3)22(16-18)32-4/h8-9,11-14,16-17H,5-7,10,15H2,1-4H3,(H,26,29) |
| InChIKey | RHFQLMWCDDMBLN-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.61 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|