C24H29N3O4S — CID 42156454
(2R)-N-(3-methoxyphenyl)-2-[4-oxo-3-(3-propan-2-yloxypropyl)quinazolin-2-yl]sulfanylpropanamide (PubChem CID 42156454) has the molecular formula C24H29N3O4S and a molecular weight of 455.58 g/mol. Its IUPAC name is (2R)-N-(3-methoxyphenyl)-2-[4-oxo-3-(3-propan-2-yloxypropyl)quinazolin-2-yl]sulfanylpropanamide.
| Compound Name | (2R)-N-(3-methoxyphenyl)-2-[4-oxo-3-(3-propan-2-yloxypropyl)quinazolin-2-yl]sulfanylpropanamide |
|---|---|
| PubChem CID | 42156454 |
| Molecular Formula | C24H29N3O4S |
| Molecular Weight | 455.58 g/mol |
| Exact Mass | 455.19 |
| IUPAC Name | (2R)-N-(3-methoxyphenyl)-2-[4-oxo-3-(3-propan-2-yloxypropyl)quinazolin-2-yl]sulfanylpropanamide |
| SMILES | COc1cccc(NC(=O)[C@@H](C)Sc2nc3ccccc3c(=O)n2CCCOC(C)C)c1 |
| InChI | InChI=1S/C24H29N3O4S/c1-16(2)31-14-8-13-27-23(29)20-11-5-6-12-21(20)26-24(27)32-17(3)22(28)25-18-9-7-10-19(15-18)30-4/h5-7,9-12,15-17H,8,13-14H2,1-4H3,(H,25,28)/t17-/m1/s1 |
| InChIKey | WRBJICUETZGXCH-QGZVFWFLSA-N |
| XLogP | 4.34 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.58 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|