C21H21F2N3O3S — CID 55423942
N-(3,4-difluorophenyl)-2-[3-(3-methoxypropyl)-4-oxoquinazolin-2-yl]sulfanylpropanamide (PubChem CID 55423942) has the molecular formula C21H21F2N3O3S and a molecular weight of 433.48 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-2-[3-(3-methoxypropyl)-4-oxoquinazolin-2-yl]sulfanylpropanamide.
| Compound Name | N-(3,4-difluorophenyl)-2-[3-(3-methoxypropyl)-4-oxoquinazolin-2-yl]sulfanylpropanamide |
|---|---|
| PubChem CID | 55423942 |
| Molecular Formula | C21H21F2N3O3S |
| Molecular Weight | 433.48 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | N-(3,4-difluorophenyl)-2-[3-(3-methoxypropyl)-4-oxoquinazolin-2-yl]sulfanylpropanamide |
| SMILES | COCCCn1c(SC(C)C(=O)Nc2ccc(F)c(F)c2)nc2ccccc2c1=O |
| InChI | InChI=1S/C21H21F2N3O3S/c1-13(19(27)24-14-8-9-16(22)17(23)12-14)30-21-25-18-7-4-3-6-15(18)20(28)26(21)10-5-11-29-2/h3-4,6-9,12-13H,5,10-11H2,1-2H3,(H,24,27) |
| InChIKey | NHFPWMLCBGIAEW-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.48 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|