C21H21FN2O3S — CID 7803407
2-[(2R)-1-(4-fluorophenyl)-1-oxopropan-2-yl]sulfanyl-3-(3-methoxypropyl)quinazolin-4-one (PubChem CID 7803407) has the molecular formula C21H21FN2O3S and a molecular weight of 400.48 g/mol. Its IUPAC name is 2-[(2R)-1-(4-fluorophenyl)-1-oxopropan-2-yl]sulfanyl-3-(3-methoxypropyl)quinazolin-4-one.
| Compound Name | 2-[(2R)-1-(4-fluorophenyl)-1-oxopropan-2-yl]sulfanyl-3-(3-methoxypropyl)quinazolin-4-one |
|---|---|
| PubChem CID | 7803407 |
| Molecular Formula | C21H21FN2O3S |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | 2-[(2R)-1-(4-fluorophenyl)-1-oxopropan-2-yl]sulfanyl-3-(3-methoxypropyl)quinazolin-4-one |
| SMILES | COCCCn1c(S[C@H](C)C(=O)c2ccc(F)cc2)nc2ccccc2c1=O |
| InChI | InChI=1S/C21H21FN2O3S/c1-14(19(25)15-8-10-16(22)11-9-15)28-21-23-18-7-4-3-6-17(18)20(26)24(21)12-5-13-27-2/h3-4,6-11,14H,5,12-13H2,1-2H3/t14-/m1/s1 |
| InChIKey | GDOQPUFNDXAJNF-CQSZACIVSA-N |
| XLogP | 3.94 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|