C26H33N3O3S — CID 42975957
N-benzyl-N-ethyl-2-[4-oxo-3-(3-propan-2-yloxypropyl)quinazolin-2-yl]sulfanylpropanamide (PubChem CID 42975957) has the molecular formula C26H33N3O3S and a molecular weight of 467.64 g/mol. Its IUPAC name is N-benzyl-N-ethyl-2-[4-oxo-3-(3-propan-2-yloxypropyl)quinazolin-2-yl]sulfanylpropanamide.
| Compound Name | N-benzyl-N-ethyl-2-[4-oxo-3-(3-propan-2-yloxypropyl)quinazolin-2-yl]sulfanylpropanamide |
|---|---|
| PubChem CID | 42975957 |
| Molecular Formula | C26H33N3O3S |
| Molecular Weight | 467.64 g/mol |
| Exact Mass | 467.22 |
| IUPAC Name | N-benzyl-N-ethyl-2-[4-oxo-3-(3-propan-2-yloxypropyl)quinazolin-2-yl]sulfanylpropanamide |
| SMILES | CCN(Cc1ccccc1)C(=O)C(C)Sc1nc2ccccc2c(=O)n1CCCOC(C)C |
| InChI | InChI=1S/C26H33N3O3S/c1-5-28(18-21-12-7-6-8-13-21)24(30)20(4)33-26-27-23-15-10-9-14-22(23)25(31)29(26)16-11-17-32-19(2)3/h6-10,12-15,19-20H,5,11,16-18H2,1-4H3 |
| InChIKey | FCFALMPAVKSQBA-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.64 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|