C24H35N3O3S — CID 55309208
2-[1-(2-ethylpiperidin-1-yl)-1-oxopropan-2-yl]sulfanyl-3-(3-propan-2-yloxypropyl)quinazolin-4-one (PubChem CID 55309208) has the molecular formula C24H35N3O3S and a molecular weight of 445.63 g/mol. Its IUPAC name is 2-[1-(2-ethylpiperidin-1-yl)-1-oxopropan-2-yl]sulfanyl-3-(3-propan-2-yloxypropyl)quinazolin-4-one.
| Compound Name | 2-[1-(2-ethylpiperidin-1-yl)-1-oxopropan-2-yl]sulfanyl-3-(3-propan-2-yloxypropyl)quinazolin-4-one |
|---|---|
| PubChem CID | 55309208 |
| Molecular Formula | C24H35N3O3S |
| Molecular Weight | 445.63 g/mol |
| Exact Mass | 445.24 |
| IUPAC Name | 2-[1-(2-ethylpiperidin-1-yl)-1-oxopropan-2-yl]sulfanyl-3-(3-propan-2-yloxypropyl)quinazolin-4-one |
| SMILES | CCC1CCCCN1C(=O)C(C)Sc1nc2ccccc2c(=O)n1CCCOC(C)C |
| InChI | InChI=1S/C24H35N3O3S/c1-5-19-11-8-9-14-26(19)22(28)18(4)31-24-25-21-13-7-6-12-20(21)23(29)27(24)15-10-16-30-17(2)3/h6-7,12-13,17-19H,5,8-11,14-16H2,1-4H3 |
| InChIKey | IIUZPKPNZITPSV-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.63 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|