C23H27N3O3S — CID 2617250
(2R)-2-[3-(3-ethoxypropyl)-4-oxoquinazolin-2-yl]sulfanyl-N-methyl-N-phenylpropanamide (PubChem CID 2617250) has the molecular formula C23H27N3O3S and a molecular weight of 425.55 g/mol. Its IUPAC name is (2R)-2-[3-(3-ethoxypropyl)-4-oxoquinazolin-2-yl]sulfanyl-N-methyl-N-phenylpropanamide.
| Compound Name | (2R)-2-[3-(3-ethoxypropyl)-4-oxoquinazolin-2-yl]sulfanyl-N-methyl-N-phenylpropanamide |
|---|---|
| PubChem CID | 2617250 |
| Molecular Formula | C23H27N3O3S |
| Molecular Weight | 425.55 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | (2R)-2-[3-(3-ethoxypropyl)-4-oxoquinazolin-2-yl]sulfanyl-N-methyl-N-phenylpropanamide |
| SMILES | CCOCCCn1c(S[C@H](C)C(=O)N(C)c2ccccc2)nc2ccccc2c1=O |
| InChI | InChI=1S/C23H27N3O3S/c1-4-29-16-10-15-26-22(28)19-13-8-9-14-20(19)24-23(26)30-17(2)21(27)25(3)18-11-6-5-7-12-18/h5-9,11-14,17H,4,10,15-16H2,1-3H3/t17-/m1/s1 |
| InChIKey | JHDWSWFHMLQJRN-QGZVFWFLSA-N |
| XLogP | 3.97 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.55 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|