C22H31N3O2S — CID 55317625
2-(3-butyl-4-oxoquinazolin-2-yl)sulfanyl-N-cyclohexyl-N-methylpropanamide (PubChem CID 55317625) has the molecular formula C22H31N3O2S and a molecular weight of 401.58 g/mol. Its IUPAC name is 2-(3-butyl-4-oxoquinazolin-2-yl)sulfanyl-N-cyclohexyl-N-methylpropanamide.
| Compound Name | 2-(3-butyl-4-oxoquinazolin-2-yl)sulfanyl-N-cyclohexyl-N-methylpropanamide |
|---|---|
| PubChem CID | 55317625 |
| Molecular Formula | C22H31N3O2S |
| Molecular Weight | 401.58 g/mol |
| Exact Mass | 401.21 |
| IUPAC Name | 2-(3-butyl-4-oxoquinazolin-2-yl)sulfanyl-N-cyclohexyl-N-methylpropanamide |
| SMILES | CCCCn1c(SC(C)C(=O)N(C)C2CCCCC2)nc2ccccc2c1=O |
| InChI | InChI=1S/C22H31N3O2S/c1-4-5-15-25-21(27)18-13-9-10-14-19(18)23-22(25)28-16(2)20(26)24(3)17-11-7-6-8-12-17/h9-10,13-14,16-17H,4-8,11-12,15H2,1-3H3 |
| InChIKey | JOSUQJYFEKREHM-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.58 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |