C24H33N3O2S — CID 7988544
(2R)-N-cyclohexyl-2-(3-cyclopentyl-4-oxoquinazolin-2-yl)sulfanyl-N-ethylpropanamide (PubChem CID 7988544) has the molecular formula C24H33N3O2S and a molecular weight of 427.61 g/mol. Its IUPAC name is (2R)-N-cyclohexyl-2-(3-cyclopentyl-4-oxoquinazolin-2-yl)sulfanyl-N-ethylpropanamide.
| Compound Name | (2R)-N-cyclohexyl-2-(3-cyclopentyl-4-oxoquinazolin-2-yl)sulfanyl-N-ethylpropanamide |
|---|---|
| PubChem CID | 7988544 |
| Molecular Formula | C24H33N3O2S |
| Molecular Weight | 427.61 g/mol |
| Exact Mass | 427.23 |
| IUPAC Name | (2R)-N-cyclohexyl-2-(3-cyclopentyl-4-oxoquinazolin-2-yl)sulfanyl-N-ethylpropanamide |
| SMILES | CCN(C(=O)[C@@H](C)Sc1nc2ccccc2c(=O)n1C1CCCC1)C1CCCCC1 |
| InChI | InChI=1S/C24H33N3O2S/c1-3-26(18-11-5-4-6-12-18)22(28)17(2)30-24-25-21-16-10-9-15-20(21)23(29)27(24)19-13-7-8-14-19/h9-10,15-19H,3-8,11-14H2,1-2H3/t17-/m1/s1 |
| InChIKey | SVPSSXZRUHHFIC-QGZVFWFLSA-N |
| XLogP | 5.17 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.61 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |