C22H24ClN3O3S — CID 43024010
2-[7-chloro-3-(3-ethoxypropyl)-4-oxoquinazolin-2-yl]sulfanyl-N-phenylpropanamide (PubChem CID 43024010) has the molecular formula C22H24ClN3O3S and a molecular weight of 445.97 g/mol. Its IUPAC name is 2-[7-chloro-3-(3-ethoxypropyl)-4-oxoquinazolin-2-yl]sulfanyl-N-phenylpropanamide.
| Compound Name | 2-[7-chloro-3-(3-ethoxypropyl)-4-oxoquinazolin-2-yl]sulfanyl-N-phenylpropanamide |
|---|---|
| PubChem CID | 43024010 |
| Molecular Formula | C22H24ClN3O3S |
| Molecular Weight | 445.97 g/mol |
| Exact Mass | 445.12 |
| IUPAC Name | 2-[7-chloro-3-(3-ethoxypropyl)-4-oxoquinazolin-2-yl]sulfanyl-N-phenylpropanamide |
| SMILES | CCOCCCn1c(SC(C)C(=O)Nc2ccccc2)nc2cc(Cl)ccc2c1=O |
| InChI | InChI=1S/C22H24ClN3O3S/c1-3-29-13-7-12-26-21(28)18-11-10-16(23)14-19(18)25-22(26)30-15(2)20(27)24-17-8-5-4-6-9-17/h4-6,8-11,14-15H,3,7,12-13H2,1-2H3,(H,24,27) |
| InChIKey | UARDFFAFCQCFJV-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.97 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|