C23H32ClN3O3S — CID 43024016
2-[7-chloro-3-(3-ethoxypropyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(2-methylcyclohexyl)propanamide (PubChem CID 43024016) has the molecular formula C23H32ClN3O3S and a molecular weight of 466.05 g/mol. Its IUPAC name is 2-[7-chloro-3-(3-ethoxypropyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(2-methylcyclohexyl)propanamide.
| Compound Name | 2-[7-chloro-3-(3-ethoxypropyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(2-methylcyclohexyl)propanamide |
|---|---|
| PubChem CID | 43024016 |
| Molecular Formula | C23H32ClN3O3S |
| Molecular Weight | 466.05 g/mol |
| Exact Mass | 465.19 |
| IUPAC Name | 2-[7-chloro-3-(3-ethoxypropyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(2-methylcyclohexyl)propanamide |
| SMILES | CCOCCCn1c(SC(C)C(=O)NC2CCCCC2C)nc2cc(Cl)ccc2c1=O |
| InChI | InChI=1S/C23H32ClN3O3S/c1-4-30-13-7-12-27-22(29)18-11-10-17(24)14-20(18)26-23(27)31-16(3)21(28)25-19-9-6-5-8-15(19)2/h10-11,14-16,19H,4-9,12-13H2,1-3H3,(H,25,28) |
| InChIKey | RZWVNUNBGJYHTK-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.05 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|