C29H30N2O3S — CID 16538776
2-[1,2-bis(4-methylphenyl)-2-oxoethyl]sulfanyl-3-(3-ethoxypropyl)quinazolin-4-one (PubChem CID 16538776) has the molecular formula C29H30N2O3S and a molecular weight of 486.64 g/mol. Its IUPAC name is 2-[1,2-bis(4-methylphenyl)-2-oxoethyl]sulfanyl-3-(3-ethoxypropyl)quinazolin-4-one.
| Compound Name | 2-[1,2-bis(4-methylphenyl)-2-oxoethyl]sulfanyl-3-(3-ethoxypropyl)quinazolin-4-one |
|---|---|
| PubChem CID | 16538776 |
| Molecular Formula | C29H30N2O3S |
| Molecular Weight | 486.64 g/mol |
| Exact Mass | 486.20 |
| IUPAC Name | 2-[1,2-bis(4-methylphenyl)-2-oxoethyl]sulfanyl-3-(3-ethoxypropyl)quinazolin-4-one |
| SMILES | CCOCCCn1c(SC(C(=O)c2ccc(C)cc2)c2ccc(C)cc2)nc2ccccc2c1=O |
| InChI | InChI=1S/C29H30N2O3S/c1-4-34-19-7-18-31-28(33)24-8-5-6-9-25(24)30-29(31)35-27(23-16-12-21(3)13-17-23)26(32)22-14-10-20(2)11-15-22/h5-6,8-17,27H,4,7,18-19H2,1-3H3 |
| InChIKey | BNXURAZEXRYBJS-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.64 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|