C25H28FN3O3S — CID 16588555
N-cyclopropyl-2-(4-fluorophenyl)-2-[4-oxo-3-(3-propan-2-yloxypropyl)quinazolin-2-yl]sulfanylacetamide (PubChem CID 16588555) has the molecular formula C25H28FN3O3S and a molecular weight of 469.58 g/mol. Its IUPAC name is N-cyclopropyl-2-(4-fluorophenyl)-2-[4-oxo-3-(3-propan-2-yloxypropyl)quinazolin-2-yl]sulfanylacetamide.
| Compound Name | N-cyclopropyl-2-(4-fluorophenyl)-2-[4-oxo-3-(3-propan-2-yloxypropyl)quinazolin-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 16588555 |
| Molecular Formula | C25H28FN3O3S |
| Molecular Weight | 469.58 g/mol |
| Exact Mass | 469.18 |
| IUPAC Name | N-cyclopropyl-2-(4-fluorophenyl)-2-[4-oxo-3-(3-propan-2-yloxypropyl)quinazolin-2-yl]sulfanylacetamide |
| SMILES | CC(C)OCCCn1c(SC(C(=O)NC2CC2)c2ccc(F)cc2)nc2ccccc2c1=O |
| InChI | InChI=1S/C25H28FN3O3S/c1-16(2)32-15-5-14-29-24(31)20-6-3-4-7-21(20)28-25(29)33-22(23(30)27-19-12-13-19)17-8-10-18(26)11-9-17/h3-4,6-11,16,19,22H,5,12-15H2,1-2H3,(H,27,30) |
| InChIKey | FBCFDVOUBWXGRG-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.58 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|