C21H22N2O4S — CID 9360454
ethyl (2S)-2-[3-(2-methoxyethyl)-4-oxoquinazolin-2-yl]sulfanyl-2-phenylacetate (PubChem CID 9360454) has the molecular formula C21H22N2O4S and a molecular weight of 398.48 g/mol. Its IUPAC name is ethyl (2S)-2-[3-(2-methoxyethyl)-4-oxoquinazolin-2-yl]sulfanyl-2-phenylacetate.
| Compound Name | ethyl (2S)-2-[3-(2-methoxyethyl)-4-oxoquinazolin-2-yl]sulfanyl-2-phenylacetate |
|---|---|
| PubChem CID | 9360454 |
| Molecular Formula | C21H22N2O4S |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | ethyl (2S)-2-[3-(2-methoxyethyl)-4-oxoquinazolin-2-yl]sulfanyl-2-phenylacetate |
| SMILES | CCOC(=O)[C@@H](Sc1nc2ccccc2c(=O)n1CCOC)c1ccccc1 |
| InChI | InChI=1S/C21H22N2O4S/c1-3-27-20(25)18(15-9-5-4-6-10-15)28-21-22-17-12-8-7-11-16(17)19(24)23(21)13-14-26-2/h4-12,18H,3,13-14H2,1-2H3/t18-/m0/s1 |
| InChIKey | NSRBCTUHOHMROF-SFHVURJKSA-N |
| XLogP | 3.44 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |