C23H25N3O5S — CID 3173058
ethyl 2-(N-[2-[3-(2-methoxyethyl)-4-oxoquinazolin-2-yl]sulfanylacetyl]anilino)acetate (PubChem CID 3173058) has the molecular formula C23H25N3O5S and a molecular weight of 455.54 g/mol. Its IUPAC name is ethyl 2-(N-[2-[3-(2-methoxyethyl)-4-oxoquinazolin-2-yl]sulfanylacetyl]anilino)acetate.
| Compound Name | ethyl 2-(N-[2-[3-(2-methoxyethyl)-4-oxoquinazolin-2-yl]sulfanylacetyl]anilino)acetate |
|---|---|
| PubChem CID | 3173058 |
| Molecular Formula | C23H25N3O5S |
| Molecular Weight | 455.54 g/mol |
| Exact Mass | 455.15 |
| IUPAC Name | ethyl 2-(N-[2-[3-(2-methoxyethyl)-4-oxoquinazolin-2-yl]sulfanylacetyl]anilino)acetate |
| SMILES | CCOC(=O)CN(C(=O)CSc1nc2ccccc2c(=O)n1CCOC)c1ccccc1 |
| InChI | InChI=1S/C23H25N3O5S/c1-3-31-21(28)15-26(17-9-5-4-6-10-17)20(27)16-32-23-24-19-12-8-7-11-18(19)22(29)25(23)13-14-30-2/h4-12H,3,13-16H2,1-2H3 |
| InChIKey | NPPUCMZAYMEGDJ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 90.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.54 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |