C14H17N5O3S — CID 8934279
ethyl 2-(N-[2-(1-methyltetrazol-5-yl)sulfanylacetyl]anilino)acetate (PubChem CID 8934279) has the molecular formula C14H17N5O3S and a molecular weight of 335.39 g/mol. Its IUPAC name is ethyl 2-(N-[2-(1-methyltetrazol-5-yl)sulfanylacetyl]anilino)acetate.
| Compound Name | ethyl 2-(N-[2-(1-methyltetrazol-5-yl)sulfanylacetyl]anilino)acetate |
|---|---|
| PubChem CID | 8934279 |
| Molecular Formula | C14H17N5O3S |
| Molecular Weight | 335.39 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | ethyl 2-(N-[2-(1-methyltetrazol-5-yl)sulfanylacetyl]anilino)acetate |
| SMILES | CCOC(=O)CN(C(=O)CSc1nnnn1C)c1ccccc1 |
| InChI | InChI=1S/C14H17N5O3S/c1-3-22-13(21)9-19(11-7-5-4-6-8-11)12(20)10-23-14-15-16-17-18(14)2/h4-8H,3,9-10H2,1-2H3 |
| InChIKey | ANPHJWKMUZZQRF-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 90.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.39 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |