C17H16ClN5OS — CID 2610496
2-[1-(4-chlorophenyl)tetrazol-5-yl]sulfanyl-N-ethyl-N-phenylacetamide (PubChem CID 2610496) has the molecular formula C17H16ClN5OS and a molecular weight of 373.87 g/mol. Its IUPAC name is 2-[1-(4-chlorophenyl)tetrazol-5-yl]sulfanyl-N-ethyl-N-phenylacetamide.
| Compound Name | 2-[1-(4-chlorophenyl)tetrazol-5-yl]sulfanyl-N-ethyl-N-phenylacetamide |
|---|---|
| PubChem CID | 2610496 |
| Molecular Formula | C17H16ClN5OS |
| Molecular Weight | 373.87 g/mol |
| Exact Mass | 373.08 |
| IUPAC Name | 2-[1-(4-chlorophenyl)tetrazol-5-yl]sulfanyl-N-ethyl-N-phenylacetamide |
| SMILES | CCN(C(=O)CSc1nnnn1-c1ccc(Cl)cc1)c1ccccc1 |
| InChI | InChI=1S/C17H16ClN5OS/c1-2-22(14-6-4-3-5-7-14)16(24)12-25-17-19-20-21-23(17)15-10-8-13(18)9-11-15/h3-11H,2,12H2,1H3 |
| InChIKey | ASVOPCDLGRSPQP-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.87 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |