C13H16BrN5OS — CID 5022235
2-[1-(4-bromophenyl)tetrazol-5-yl]sulfanyl-N,N-diethylacetamide (PubChem CID 5022235) has the molecular formula C13H16BrN5OS and a molecular weight of 370.28 g/mol. Its IUPAC name is 2-[1-(4-bromophenyl)tetrazol-5-yl]sulfanyl-N,N-diethylacetamide.
| Compound Name | 2-[1-(4-bromophenyl)tetrazol-5-yl]sulfanyl-N,N-diethylacetamide |
|---|---|
| PubChem CID | 5022235 |
| Molecular Formula | C13H16BrN5OS |
| Molecular Weight | 370.28 g/mol |
| Exact Mass | 369.03 |
| IUPAC Name | 2-[1-(4-bromophenyl)tetrazol-5-yl]sulfanyl-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)CSc1nnnn1-c1ccc(Br)cc1 |
| InChI | InChI=1S/C13H16BrN5OS/c1-3-18(4-2)12(20)9-21-13-15-16-17-19(13)11-7-5-10(14)6-8-11/h5-8H,3-4,9H2,1-2H3 |
| InChIKey | NDLSIUKHPGKHOO-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.28 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |