C16H13ClN5O2S- — CID 22305422
N-(4-chlorophenyl)-N-[2-(1-phenyltetrazol-5-yl)sulfanylethyl]carbamate (PubChem CID 22305422) has the molecular formula C16H13ClN5O2S- and a molecular weight of 374.83 g/mol. Its IUPAC name is N-(4-chlorophenyl)-N-[2-(1-phenyltetrazol-5-yl)sulfanylethyl]carbamate.
| Compound Name | N-(4-chlorophenyl)-N-[2-(1-phenyltetrazol-5-yl)sulfanylethyl]carbamate |
|---|---|
| PubChem CID | 22305422 |
| Molecular Formula | C16H13ClN5O2S- |
| Molecular Weight | 374.83 g/mol |
| Exact Mass | 374.05 |
| IUPAC Name | N-(4-chlorophenyl)-N-[2-(1-phenyltetrazol-5-yl)sulfanylethyl]carbamate |
| SMILES | O=C([O-])N(CCSc1nnnn1-c1ccccc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H14ClN5O2S/c17-12-6-8-13(9-7-12)21(16(23)24)10-11-25-15-18-19-20-22(15)14-4-2-1-3-5-14/h1-9H,10-11H2,(H,23,24)/p-1 |
| InChIKey | FDLNNQGVOWQSTN-UHFFFAOYSA-M |
| XLogP | 2.26 |
| TPSA | 86.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.83 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |