C16H13Cl2N5OS — CID 4750116
2,4-dichloro-N-[2-(1-phenyltetrazol-5-yl)sulfanylethyl]benzamide (PubChem CID 4750116) has the molecular formula C16H13Cl2N5OS and a molecular weight of 394.29 g/mol. Its IUPAC name is 2,4-dichloro-N-[2-(1-phenyltetrazol-5-yl)sulfanylethyl]benzamide.
| Compound Name | 2,4-dichloro-N-[2-(1-phenyltetrazol-5-yl)sulfanylethyl]benzamide |
|---|---|
| PubChem CID | 4750116 |
| Molecular Formula | C16H13Cl2N5OS |
| Molecular Weight | 394.29 g/mol |
| Exact Mass | 393.02 |
| IUPAC Name | 2,4-dichloro-N-[2-(1-phenyltetrazol-5-yl)sulfanylethyl]benzamide |
| SMILES | O=C(NCCSc1nnnn1-c1ccccc1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H13Cl2N5OS/c17-11-6-7-13(14(18)10-11)15(24)19-8-9-25-16-20-21-22-23(16)12-4-2-1-3-5-12/h1-7,10H,8-9H2,(H,19,24) |
| InChIKey | WEUJMQHFDHLEFE-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.29 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|