C20H19ClN2O3S — CID 177056525
ethyl 2-(6-chloro-3-ethyl-4-oxoquinazolin-2-yl)sulfanyl-2-phenylacetate (PubChem CID 177056525) has the molecular formula C20H19ClN2O3S and a molecular weight of 402.90 g/mol. Its IUPAC name is ethyl 2-(6-chloro-3-ethyl-4-oxoquinazolin-2-yl)sulfanyl-2-phenylacetate.
| Compound Name | ethyl 2-(6-chloro-3-ethyl-4-oxoquinazolin-2-yl)sulfanyl-2-phenylacetate |
|---|---|
| PubChem CID | 177056525 |
| Molecular Formula | C20H19ClN2O3S |
| Molecular Weight | 402.90 g/mol |
| Exact Mass | 402.08 |
| IUPAC Name | ethyl 2-(6-chloro-3-ethyl-4-oxoquinazolin-2-yl)sulfanyl-2-phenylacetate |
| SMILES | CCOC(=O)C(Sc1nc2ccc(Cl)cc2c(=O)n1CC)c1ccccc1 |
| InChI | InChI=1S/C20H19ClN2O3S/c1-3-23-18(24)15-12-14(21)10-11-16(15)22-20(23)27-17(19(25)26-4-2)13-8-6-5-7-9-13/h5-12,17H,3-4H2,1-2H3 |
| InChIKey | VEUJYNRBSMEWIS-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.90 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |