C22H24N2O4S — CID 7845779
ethyl 2-[(1R)-2-ethoxy-2-oxo-1-phenylethyl]sulfanyl-1-ethylbenzimidazole-5-carboxylate (PubChem CID 7845779) has the molecular formula C22H24N2O4S and a molecular weight of 412.51 g/mol. Its IUPAC name is ethyl 2-[(1R)-2-ethoxy-2-oxo-1-phenylethyl]sulfanyl-1-ethylbenzimidazole-5-carboxylate.
| Compound Name | ethyl 2-[(1R)-2-ethoxy-2-oxo-1-phenylethyl]sulfanyl-1-ethylbenzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 7845779 |
| Molecular Formula | C22H24N2O4S |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | ethyl 2-[(1R)-2-ethoxy-2-oxo-1-phenylethyl]sulfanyl-1-ethylbenzimidazole-5-carboxylate |
| SMILES | CCOC(=O)c1ccc2c(c1)nc(S[C@@H](C(=O)OCC)c1ccccc1)n2CC |
| InChI | InChI=1S/C22H24N2O4S/c1-4-24-18-13-12-16(20(25)27-5-2)14-17(18)23-22(24)29-19(21(26)28-6-3)15-10-8-7-9-11-15/h7-14,19H,4-6H2,1-3H3/t19-/m1/s1 |
| InChIKey | ISBHXMZGNWRNAE-LJQANCHMSA-N |
| XLogP | 4.63 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |