C26H26N2O2 — CID 7996375
ethyl 2-(2,2-diphenylethyl)-1-ethylbenzimidazole-5-carboxylate (PubChem CID 7996375) has the molecular formula C26H26N2O2 and a molecular weight of 398.51 g/mol. Its IUPAC name is ethyl 2-(2,2-diphenylethyl)-1-ethylbenzimidazole-5-carboxylate.
| Compound Name | ethyl 2-(2,2-diphenylethyl)-1-ethylbenzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 7996375 |
| Molecular Formula | C26H26N2O2 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | ethyl 2-(2,2-diphenylethyl)-1-ethylbenzimidazole-5-carboxylate |
| SMILES | CCOC(=O)c1ccc2c(c1)nc(CC(c1ccccc1)c1ccccc1)n2CC |
| InChI | InChI=1S/C26H26N2O2/c1-3-28-24-16-15-21(26(29)30-4-2)17-23(24)27-25(28)18-22(19-11-7-5-8-12-19)20-13-9-6-10-14-20/h5-17,22H,3-4,18H2,1-2H3 |
| InChIKey | XDOWZTTXRMOSHH-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |