C27H28N2O3 — CID 15546117
ethyl 4-[[5-[hydroxy(phenyl)methyl]-2-propylbenzimidazol-1-yl]methyl]benzoate (PubChem CID 15546117) has the molecular formula C27H28N2O3 and a molecular weight of 428.53 g/mol. Its IUPAC name is ethyl 4-[[5-[hydroxy(phenyl)methyl]-2-propylbenzimidazol-1-yl]methyl]benzoate.
| Compound Name | ethyl 4-[[5-[hydroxy(phenyl)methyl]-2-propylbenzimidazol-1-yl]methyl]benzoate |
|---|---|
| PubChem CID | 15546117 |
| Molecular Formula | C27H28N2O3 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | ethyl 4-[[5-[hydroxy(phenyl)methyl]-2-propylbenzimidazol-1-yl]methyl]benzoate |
| SMILES | CCCc1nc2cc(C(O)c3ccccc3)ccc2n1Cc1ccc(C(=O)OCC)cc1 |
| InChI | InChI=1S/C27H28N2O3/c1-3-8-25-28-23-17-22(26(30)20-9-6-5-7-10-20)15-16-24(23)29(25)18-19-11-13-21(14-12-19)27(31)32-4-2/h5-7,9-17,26,30H,3-4,8,18H2,1-2H3 |
| InChIKey | UFZGNCZHOBTVDM-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |