C25H22F2N2O3S — CID 46101480
ethyl 1-benzyl-2-[[4-(difluoromethoxy)phenyl]methylsulfanyl]benzimidazole-5-carboxylate (PubChem CID 46101480) has the molecular formula C25H22F2N2O3S and a molecular weight of 468.53 g/mol. Its IUPAC name is ethyl 1-benzyl-2-[[4-(difluoromethoxy)phenyl]methylsulfanyl]benzimidazole-5-carboxylate.
| Compound Name | ethyl 1-benzyl-2-[[4-(difluoromethoxy)phenyl]methylsulfanyl]benzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 46101480 |
| Molecular Formula | C25H22F2N2O3S |
| Molecular Weight | 468.53 g/mol |
| Exact Mass | 468.13 |
| IUPAC Name | ethyl 1-benzyl-2-[[4-(difluoromethoxy)phenyl]methylsulfanyl]benzimidazole-5-carboxylate |
| SMILES | CCOC(=O)c1ccc2c(c1)nc(SCc1ccc(OC(F)F)cc1)n2Cc1ccccc1 |
| InChI | InChI=1S/C25H22F2N2O3S/c1-2-31-23(30)19-10-13-22-21(14-19)28-25(29(22)15-17-6-4-3-5-7-17)33-16-18-8-11-20(12-9-18)32-24(26)27/h3-14,24H,2,15-16H2,1H3 |
| InChIKey | LCBNQVGBONWMFY-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.53 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |