C24H20BrFN2O2S — CID 46101486
ethyl 1-benzyl-2-[(4-bromo-2-fluorophenyl)methylsulfanyl]benzimidazole-5-carboxylate (PubChem CID 46101486) has the molecular formula C24H20BrFN2O2S and a molecular weight of 499.41 g/mol. Its IUPAC name is ethyl 1-benzyl-2-[(4-bromo-2-fluorophenyl)methylsulfanyl]benzimidazole-5-carboxylate.
| Compound Name | ethyl 1-benzyl-2-[(4-bromo-2-fluorophenyl)methylsulfanyl]benzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 46101486 |
| Molecular Formula | C24H20BrFN2O2S |
| Molecular Weight | 499.41 g/mol |
| Exact Mass | 498.04 |
| IUPAC Name | ethyl 1-benzyl-2-[(4-bromo-2-fluorophenyl)methylsulfanyl]benzimidazole-5-carboxylate |
| SMILES | CCOC(=O)c1ccc2c(c1)nc(SCc1ccc(Br)cc1F)n2Cc1ccccc1 |
| InChI | InChI=1S/C24H20BrFN2O2S/c1-2-30-23(29)17-9-11-22-21(12-17)27-24(28(22)14-16-6-4-3-5-7-16)31-15-18-8-10-19(25)13-20(18)26/h3-13H,2,14-15H2,1H3 |
| InChIKey | TXVWGYGFTDSJJT-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.41 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |