C23H18F3N3O2S — CID 24720773
ethyl 1-(pyridin-2-ylmethyl)-2-[(3,4,5-trifluorophenyl)methylsulfanyl]benzimidazole-5-carboxylate (PubChem CID 24720773) has the molecular formula C23H18F3N3O2S and a molecular weight of 457.48 g/mol. Its IUPAC name is ethyl 1-(pyridin-2-ylmethyl)-2-[(3,4,5-trifluorophenyl)methylsulfanyl]benzimidazole-5-carboxylate.
| Compound Name | ethyl 1-(pyridin-2-ylmethyl)-2-[(3,4,5-trifluorophenyl)methylsulfanyl]benzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 24720773 |
| Molecular Formula | C23H18F3N3O2S |
| Molecular Weight | 457.48 g/mol |
| Exact Mass | 457.11 |
| IUPAC Name | ethyl 1-(pyridin-2-ylmethyl)-2-[(3,4,5-trifluorophenyl)methylsulfanyl]benzimidazole-5-carboxylate |
| SMILES | CCOC(=O)c1ccc2c(c1)nc(SCc1cc(F)c(F)c(F)c1)n2Cc1ccccn1 |
| InChI | InChI=1S/C23H18F3N3O2S/c1-2-31-22(30)15-6-7-20-19(11-15)28-23(29(20)12-16-5-3-4-8-27-16)32-13-14-9-17(24)21(26)18(25)10-14/h3-11H,2,12-13H2,1H3 |
| InChIKey | KRMHCCONWIOBCU-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.48 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|