C34H32N2O3S — CID 75145110
ethyl 1-[2-(4-methoxyphenyl)ethyl]-2-[[4-(2-phenylethenyl)phenyl]methylsulfanyl]benzimidazole-5-carboxylate (PubChem CID 75145110) has the molecular formula C34H32N2O3S and a molecular weight of 548.71 g/mol. Its IUPAC name is ethyl 1-[2-(4-methoxyphenyl)ethyl]-2-[[4-(2-phenylethenyl)phenyl]methylsulfanyl]benzimidazole-5-carboxylate.
| Compound Name | ethyl 1-[2-(4-methoxyphenyl)ethyl]-2-[[4-(2-phenylethenyl)phenyl]methylsulfanyl]benzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 75145110 |
| Molecular Formula | C34H32N2O3S |
| Molecular Weight | 548.71 g/mol |
| Exact Mass | 548.21 |
| IUPAC Name | ethyl 1-[2-(4-methoxyphenyl)ethyl]-2-[[4-(2-phenylethenyl)phenyl]methylsulfanyl]benzimidazole-5-carboxylate |
| SMILES | CCOC(=O)c1ccc2c(c1)nc(SCc1ccc(C=Cc3ccccc3)cc1)n2CCc1ccc(OC)cc1 |
| InChI | InChI=1S/C34H32N2O3S/c1-3-39-33(37)29-17-20-32-31(23-29)35-34(36(32)22-21-27-15-18-30(38-2)19-16-27)40-24-28-13-11-26(12-14-28)10-9-25-7-5-4-6-8-25/h4-20,23H,3,21-22,24H2,1-2H3 |
| InChIKey | LIHKVIMGWNGDHK-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.71 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|