C23H28N2O3S2 — CID 46101797
ethyl 1-(3-ethoxypropyl)-2-[(4-methylsulfanylphenyl)methylsulfanyl]benzimidazole-5-carboxylate (PubChem CID 46101797) has the molecular formula C23H28N2O3S2 and a molecular weight of 444.62 g/mol. Its IUPAC name is ethyl 1-(3-ethoxypropyl)-2-[(4-methylsulfanylphenyl)methylsulfanyl]benzimidazole-5-carboxylate.
| Compound Name | ethyl 1-(3-ethoxypropyl)-2-[(4-methylsulfanylphenyl)methylsulfanyl]benzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 46101797 |
| Molecular Formula | C23H28N2O3S2 |
| Molecular Weight | 444.62 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | ethyl 1-(3-ethoxypropyl)-2-[(4-methylsulfanylphenyl)methylsulfanyl]benzimidazole-5-carboxylate |
| SMILES | CCOCCCn1c(SCc2ccc(SC)cc2)nc2cc(C(=O)OCC)ccc21 |
| InChI | InChI=1S/C23H28N2O3S2/c1-4-27-14-6-13-25-21-12-9-18(22(26)28-5-2)15-20(21)24-23(25)30-16-17-7-10-19(29-3)11-8-17/h7-12,15H,4-6,13-14,16H2,1-3H3 |
| InChIKey | MUVXLOCRVKOSDJ-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.62 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|