C25H30N2O5S — CID 46101776
ethyl 2-[(3-methoxycarbonylphenyl)methylsulfanyl]-1-(3-propan-2-yloxypropyl)benzimidazole-5-carboxylate (PubChem CID 46101776) has the molecular formula C25H30N2O5S and a molecular weight of 470.59 g/mol. Its IUPAC name is ethyl 2-[(3-methoxycarbonylphenyl)methylsulfanyl]-1-(3-propan-2-yloxypropyl)benzimidazole-5-carboxylate.
| Compound Name | ethyl 2-[(3-methoxycarbonylphenyl)methylsulfanyl]-1-(3-propan-2-yloxypropyl)benzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 46101776 |
| Molecular Formula | C25H30N2O5S |
| Molecular Weight | 470.59 g/mol |
| Exact Mass | 470.19 |
| IUPAC Name | ethyl 2-[(3-methoxycarbonylphenyl)methylsulfanyl]-1-(3-propan-2-yloxypropyl)benzimidazole-5-carboxylate |
| SMILES | CCOC(=O)c1ccc2c(c1)nc(SCc1cccc(C(=O)OC)c1)n2CCCOC(C)C |
| InChI | InChI=1S/C25H30N2O5S/c1-5-31-24(29)20-10-11-22-21(15-20)26-25(27(22)12-7-13-32-17(2)3)33-16-18-8-6-9-19(14-18)23(28)30-4/h6,8-11,14-15,17H,5,7,12-13,16H2,1-4H3 |
| InChIKey | WOBWPWVDJCBCSH-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 79.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.59 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|