C26H25N3O5S — CID 46101862
ethyl 1-[2-(4-methoxyphenyl)ethyl]-2-[(2-nitrophenyl)methylsulfanyl]benzimidazole-5-carboxylate (PubChem CID 46101862) has the molecular formula C26H25N3O5S and a molecular weight of 491.57 g/mol. Its IUPAC name is ethyl 1-[2-(4-methoxyphenyl)ethyl]-2-[(2-nitrophenyl)methylsulfanyl]benzimidazole-5-carboxylate.
| Compound Name | ethyl 1-[2-(4-methoxyphenyl)ethyl]-2-[(2-nitrophenyl)methylsulfanyl]benzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 46101862 |
| Molecular Formula | C26H25N3O5S |
| Molecular Weight | 491.57 g/mol |
| Exact Mass | 491.15 |
| IUPAC Name | ethyl 1-[2-(4-methoxyphenyl)ethyl]-2-[(2-nitrophenyl)methylsulfanyl]benzimidazole-5-carboxylate |
| SMILES | CCOC(=O)c1ccc2c(c1)nc(SCc1ccccc1[N+](=O)[O-])n2CCc1ccc(OC)cc1 |
| InChI | InChI=1S/C26H25N3O5S/c1-3-34-25(30)19-10-13-24-22(16-19)27-26(35-17-20-6-4-5-7-23(20)29(31)32)28(24)15-14-18-8-11-21(33-2)12-9-18/h4-13,16H,3,14-15,17H2,1-2H3 |
| InChIKey | VNUSJOGFQFNXRW-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 96.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.57 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|