C22H23ClN4O2S — CID 177055989
6-chloro-3-ethyl-2-[(1S)-2-oxo-1-phenyl-2-piperazin-1-ylethyl]sulfanylquinazolin-4-one (PubChem CID 177055989) has the molecular formula C22H23ClN4O2S and a molecular weight of 442.97 g/mol. Its IUPAC name is 6-chloro-3-ethyl-2-[(1S)-2-oxo-1-phenyl-2-piperazin-1-ylethyl]sulfanylquinazolin-4-one.
| Compound Name | 6-chloro-3-ethyl-2-[(1S)-2-oxo-1-phenyl-2-piperazin-1-ylethyl]sulfanylquinazolin-4-one |
|---|---|
| PubChem CID | 177055989 |
| Molecular Formula | C22H23ClN4O2S |
| Molecular Weight | 442.97 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | 6-chloro-3-ethyl-2-[(1S)-2-oxo-1-phenyl-2-piperazin-1-ylethyl]sulfanylquinazolin-4-one |
| SMILES | CCn1c(S[C@H](C(=O)N2CCNCC2)c2ccccc2)nc2ccc(Cl)cc2c1=O |
| InChI | InChI=1S/C22H23ClN4O2S/c1-2-27-20(28)17-14-16(23)8-9-18(17)25-22(27)30-19(15-6-4-3-5-7-15)21(29)26-12-10-24-11-13-26/h3-9,14,19,24H,2,10-13H2,1H3/t19-/m0/s1 |
| InChIKey | HKKUMPRJZGYWBH-IBGZPJMESA-N |
| XLogP | 3.34 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.97 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |