C23H25N3O2S — CID 7702486
3-ethyl-2-[(1R)-2-oxo-1-phenyl-2-piperidin-1-ylethyl]sulfanylquinazolin-4-one (PubChem CID 7702486) has the molecular formula C23H25N3O2S and a molecular weight of 407.54 g/mol. Its IUPAC name is 3-ethyl-2-[(1R)-2-oxo-1-phenyl-2-piperidin-1-ylethyl]sulfanylquinazolin-4-one.
| Compound Name | 3-ethyl-2-[(1R)-2-oxo-1-phenyl-2-piperidin-1-ylethyl]sulfanylquinazolin-4-one |
|---|---|
| PubChem CID | 7702486 |
| Molecular Formula | C23H25N3O2S |
| Molecular Weight | 407.54 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | 3-ethyl-2-[(1R)-2-oxo-1-phenyl-2-piperidin-1-ylethyl]sulfanylquinazolin-4-one |
| SMILES | CCn1c(S[C@@H](C(=O)N2CCCCC2)c2ccccc2)nc2ccccc2c1=O |
| InChI | InChI=1S/C23H25N3O2S/c1-2-26-21(27)18-13-7-8-14-19(18)24-23(26)29-20(17-11-5-3-6-12-17)22(28)25-15-9-4-10-16-25/h3,5-8,11-14,20H,2,4,9-10,15-16H2,1H3/t20-/m1/s1 |
| InChIKey | BRARZNNOPGPBCB-HXUWFJFHSA-N |
| XLogP | 4.26 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.54 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |