C37H54ClN5O4S — CID 177056534
6-chloro-3-ethyl-2-(2-oxo-1-phenyl-2-pyrrolidin-1-ylethyl)sulfanylquinazolin-4-one;ethane;3-formamido-N-(3-methylpentyl)-N-propylpropanamide (PubChem CID 177056534) has the molecular formula C37H54ClN5O4S and a molecular weight of 700.39 g/mol. Its IUPAC name is 6-chloro-3-ethyl-2-(2-oxo-1-phenyl-2-pyrrolidin-1-ylethyl)sulfanylquinazolin-4-one;ethane;3-formamido-N-(3-methylpentyl)-N-propylpropanamide.
| Compound Name | 6-chloro-3-ethyl-2-(2-oxo-1-phenyl-2-pyrrolidin-1-ylethyl)sulfanylquinazolin-4-one;ethane;3-formamido-N-(3-methylpentyl)-N-propylpropanamide |
|---|---|
| PubChem CID | 177056534 |
| Molecular Formula | C37H54ClN5O4S |
| Molecular Weight | 700.39 g/mol |
| Exact Mass | 699.36 |
| IUPAC Name | 6-chloro-3-ethyl-2-(2-oxo-1-phenyl-2-pyrrolidin-1-ylethyl)sulfanylquinazolin-4-one;ethane;3-formamido-N-(3-methylpentyl)-N-propylpropanamide |
| SMILES | CC.CCCN(CCC(C)CC)C(=O)CCNC=O.CCn1c(SC(C(=O)N2CCCC2)c2ccccc2)nc2ccc(Cl)cc2c1=O |
| InChI | InChI=1S/C22H22ClN3O2S.C13H26N2O2.C2H6/c1-2-26-20(27)17-14-16(23)10-11-18(17)24-22(26)29-19(15-8-4-3-5-9-15)21(28)25-12-6-7-13-25;1-4-9-15(10-7-12(3)5-2)13(17)6-8-14-11-16;1-2/h3-5,8-11,14,19H,2,6-7,12-13H2,1H3;11-12H,4-10H2,1-3H3,(H,14,16);1-2H3 |
| InChIKey | QFPHIPCJTYBDQC-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 104.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.39 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|