C30H43N3O4S — CID 177054321
tert-butyl formate;ethane;3-ethyl-2-(1-oxo-1-pyrrolidin-1-ylpentan-2-yl)sulfanylbenzo[g]quinazolin-4-one (PubChem CID 177054321) has the molecular formula C30H43N3O4S and a molecular weight of 541.76 g/mol. Its IUPAC name is tert-butyl formate;ethane;3-ethyl-2-(1-oxo-1-pyrrolidin-1-ylpentan-2-yl)sulfanylbenzo[g]quinazolin-4-one.
| Compound Name | tert-butyl formate;ethane;3-ethyl-2-(1-oxo-1-pyrrolidin-1-ylpentan-2-yl)sulfanylbenzo[g]quinazolin-4-one |
|---|---|
| PubChem CID | 177054321 |
| Molecular Formula | C30H43N3O4S |
| Molecular Weight | 541.76 g/mol |
| Exact Mass | 541.30 |
| IUPAC Name | tert-butyl formate;ethane;3-ethyl-2-(1-oxo-1-pyrrolidin-1-ylpentan-2-yl)sulfanylbenzo[g]quinazolin-4-one |
| SMILES | CC.CC(C)(C)OC=O.CCCC(Sc1nc2cc3ccccc3cc2c(=O)n1CC)C(=O)N1CCCC1 |
| InChI | InChI=1S/C23H27N3O2S.C5H10O2.C2H6/c1-3-9-20(22(28)25-12-7-8-13-25)29-23-24-19-15-17-11-6-5-10-16(17)14-18(19)21(27)26(23)4-2;1-5(2,3)7-4-6;1-2/h5-6,10-11,14-15,20H,3-4,7-9,12-13H2,1-2H3;4H,1-3H3;1-2H3 |
| InChIKey | MZFIWTLKZVILOC-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.76 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|