C27H32N4O5S — CID 177056343
3-ethyl-2-[1-[1-(2-hydroxyacetyl)piperidin-4-yl]-2-morpholin-4-yl-2-oxoethyl]sulfanylbenzo[g]quinazolin-4-one (PubChem CID 177056343) has the molecular formula C27H32N4O5S and a molecular weight of 524.64 g/mol. Its IUPAC name is 3-ethyl-2-[1-[1-(2-hydroxyacetyl)piperidin-4-yl]-2-morpholin-4-yl-2-oxoethyl]sulfanylbenzo[g]quinazolin-4-one.
| Compound Name | 3-ethyl-2-[1-[1-(2-hydroxyacetyl)piperidin-4-yl]-2-morpholin-4-yl-2-oxoethyl]sulfanylbenzo[g]quinazolin-4-one |
|---|---|
| PubChem CID | 177056343 |
| Molecular Formula | C27H32N4O5S |
| Molecular Weight | 524.64 g/mol |
| Exact Mass | 524.21 |
| IUPAC Name | 3-ethyl-2-[1-[1-(2-hydroxyacetyl)piperidin-4-yl]-2-morpholin-4-yl-2-oxoethyl]sulfanylbenzo[g]quinazolin-4-one |
| SMILES | CCn1c(SC(C(=O)N2CCOCC2)C2CCN(C(=O)CO)CC2)nc2cc3ccccc3cc2c1=O |
| InChI | InChI=1S/C27H32N4O5S/c1-2-31-25(34)21-15-19-5-3-4-6-20(19)16-22(21)28-27(31)37-24(26(35)30-11-13-36-14-12-30)18-7-9-29(10-8-18)23(33)17-32/h3-6,15-16,18,24,32H,2,7-14,17H2,1H3 |
| InChIKey | IHKTUNPQZXQNBP-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 104.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.64 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|