C24H19Cl2N3O2S2 — CID 44641113
N-(3,5-dichlorophenyl)-2-(4-oxo-5-phenyl-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl)sulfanylpropanamide (PubChem CID 44641113) has the molecular formula C24H19Cl2N3O2S2 and a molecular weight of 516.48 g/mol. Its IUPAC name is N-(3,5-dichlorophenyl)-2-(4-oxo-5-phenyl-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl)sulfanylpropanamide.
| Compound Name | N-(3,5-dichlorophenyl)-2-(4-oxo-5-phenyl-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl)sulfanylpropanamide |
|---|---|
| PubChem CID | 44641113 |
| Molecular Formula | C24H19Cl2N3O2S2 |
| Molecular Weight | 516.48 g/mol |
| Exact Mass | 515.03 |
| IUPAC Name | N-(3,5-dichlorophenyl)-2-(4-oxo-5-phenyl-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl)sulfanylpropanamide |
| SMILES | C=CCn1c(SC(C)C(=O)Nc2cc(Cl)cc(Cl)c2)nc2scc(-c3ccccc3)c2c1=O |
| InChI | InChI=1S/C24H19Cl2N3O2S2/c1-3-9-29-23(31)20-19(15-7-5-4-6-8-15)13-32-22(20)28-24(29)33-14(2)21(30)27-18-11-16(25)10-17(26)12-18/h3-8,10-14H,1,9H2,2H3,(H,27,30) |
| InChIKey | RRJGJFBOPNUHMZ-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.48 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|