C31H27N3O3S2 — CID 44640427
2-[5-(4-methylphenyl)-4-oxo-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl]sulfanyl-N-(4-phenoxyphenyl)propanamide (PubChem CID 44640427) has the molecular formula C31H27N3O3S2 and a molecular weight of 553.71 g/mol. Its IUPAC name is 2-[5-(4-methylphenyl)-4-oxo-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl]sulfanyl-N-(4-phenoxyphenyl)propanamide.
| Compound Name | 2-[5-(4-methylphenyl)-4-oxo-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl]sulfanyl-N-(4-phenoxyphenyl)propanamide |
|---|---|
| PubChem CID | 44640427 |
| Molecular Formula | C31H27N3O3S2 |
| Molecular Weight | 553.71 g/mol |
| Exact Mass | 553.15 |
| IUPAC Name | 2-[5-(4-methylphenyl)-4-oxo-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl]sulfanyl-N-(4-phenoxyphenyl)propanamide |
| SMILES | C=CCn1c(SC(C)C(=O)Nc2ccc(Oc3ccccc3)cc2)nc2scc(-c3ccc(C)cc3)c2c1=O |
| InChI | InChI=1S/C31H27N3O3S2/c1-4-18-34-30(36)27-26(22-12-10-20(2)11-13-22)19-38-29(27)33-31(34)39-21(3)28(35)32-23-14-16-25(17-15-23)37-24-8-6-5-7-9-24/h4-17,19,21H,1,18H2,2-3H3,(H,32,35) |
| InChIKey | IYSZLJUQADKNTA-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.71 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|