C27H27N3O3S2 — CID 44640437
N-(2-ethoxyphenyl)-2-[5-(4-methylphenyl)-4-oxo-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl]sulfanylpropanamide (PubChem CID 44640437) has the molecular formula C27H27N3O3S2 and a molecular weight of 505.67 g/mol. Its IUPAC name is N-(2-ethoxyphenyl)-2-[5-(4-methylphenyl)-4-oxo-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl]sulfanylpropanamide.
| Compound Name | N-(2-ethoxyphenyl)-2-[5-(4-methylphenyl)-4-oxo-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl]sulfanylpropanamide |
|---|---|
| PubChem CID | 44640437 |
| Molecular Formula | C27H27N3O3S2 |
| Molecular Weight | 505.67 g/mol |
| Exact Mass | 505.15 |
| IUPAC Name | N-(2-ethoxyphenyl)-2-[5-(4-methylphenyl)-4-oxo-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl]sulfanylpropanamide |
| SMILES | C=CCn1c(SC(C)C(=O)Nc2ccccc2OCC)nc2scc(-c3ccc(C)cc3)c2c1=O |
| InChI | InChI=1S/C27H27N3O3S2/c1-5-15-30-26(32)23-20(19-13-11-17(3)12-14-19)16-34-25(23)29-27(30)35-18(4)24(31)28-21-9-7-8-10-22(21)33-6-2/h5,7-14,16,18H,1,6,15H2,2-4H3,(H,28,31) |
| InChIKey | CBIICOJIAGUXCP-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.67 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|