C23H21N3O3S3 — CID 16520149
N-(2-methoxyphenyl)-2-(4-oxo-3-prop-2-enyl-5-thiophen-2-ylthieno[2,3-d]pyrimidin-2-yl)sulfanylpropanamide (PubChem CID 16520149) has the molecular formula C23H21N3O3S3 and a molecular weight of 483.64 g/mol. Its IUPAC name is N-(2-methoxyphenyl)-2-(4-oxo-3-prop-2-enyl-5-thiophen-2-ylthieno[2,3-d]pyrimidin-2-yl)sulfanylpropanamide.
| Compound Name | N-(2-methoxyphenyl)-2-(4-oxo-3-prop-2-enyl-5-thiophen-2-ylthieno[2,3-d]pyrimidin-2-yl)sulfanylpropanamide |
|---|---|
| PubChem CID | 16520149 |
| Molecular Formula | C23H21N3O3S3 |
| Molecular Weight | 483.64 g/mol |
| Exact Mass | 483.07 |
| IUPAC Name | N-(2-methoxyphenyl)-2-(4-oxo-3-prop-2-enyl-5-thiophen-2-ylthieno[2,3-d]pyrimidin-2-yl)sulfanylpropanamide |
| SMILES | C=CCn1c(SC(C)C(=O)Nc2ccccc2OC)nc2scc(-c3cccs3)c2c1=O |
| InChI | InChI=1S/C23H21N3O3S3/c1-4-11-26-22(28)19-15(18-10-7-12-30-18)13-31-21(19)25-23(26)32-14(2)20(27)24-16-8-5-6-9-17(16)29-3/h4-10,12-14H,1,11H2,2-3H3,(H,24,27) |
| InChIKey | SYMHCOVROGTWNG-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.64 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|