C27H18N2O3S3 — CID 2555498
2-[(3-oxobenzo[f]chromen-1-yl)methylsulfanyl]-3-prop-2-enyl-5-thiophen-2-ylthieno[2,3-d]pyrimidin-4-one (PubChem CID 2555498) has the molecular formula C27H18N2O3S3 and a molecular weight of 514.65 g/mol. Its IUPAC name is 2-[(3-oxobenzo[f]chromen-1-yl)methylsulfanyl]-3-prop-2-enyl-5-thiophen-2-ylthieno[2,3-d]pyrimidin-4-one.
| Compound Name | 2-[(3-oxobenzo[f]chromen-1-yl)methylsulfanyl]-3-prop-2-enyl-5-thiophen-2-ylthieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 2555498 |
| Molecular Formula | C27H18N2O3S3 |
| Molecular Weight | 514.65 g/mol |
| Exact Mass | 514.05 |
| IUPAC Name | 2-[(3-oxobenzo[f]chromen-1-yl)methylsulfanyl]-3-prop-2-enyl-5-thiophen-2-ylthieno[2,3-d]pyrimidin-4-one |
| SMILES | C=CCn1c(SCc2cc(=O)oc3ccc4ccccc4c23)nc2scc(-c3cccs3)c2c1=O |
| InChI | InChI=1S/C27H18N2O3S3/c1-2-11-29-26(31)24-19(21-8-5-12-33-21)15-34-25(24)28-27(29)35-14-17-13-22(30)32-20-10-9-16-6-3-4-7-18(16)23(17)20/h2-10,12-13,15H,1,11,14H2 |
| InChIKey | NEWNWTOYMNVJIP-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 65.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.65 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|