C15H14N2OS3 — CID 86777784
2-but-3-enylsulfanyl-3-methyl-5-thiophen-2-ylthieno[2,3-d]pyrimidin-4-one (PubChem CID 86777784) has the molecular formula C15H14N2OS3 and a molecular weight of 334.49 g/mol. Its IUPAC name is 2-but-3-enylsulfanyl-3-methyl-5-thiophen-2-ylthieno[2,3-d]pyrimidin-4-one.
| Compound Name | 2-but-3-enylsulfanyl-3-methyl-5-thiophen-2-ylthieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 86777784 |
| Molecular Formula | C15H14N2OS3 |
| Molecular Weight | 334.49 g/mol |
| Exact Mass | 334.03 |
| IUPAC Name | 2-but-3-enylsulfanyl-3-methyl-5-thiophen-2-ylthieno[2,3-d]pyrimidin-4-one |
| SMILES | C=CCCSc1nc2scc(-c3cccs3)c2c(=O)n1C |
| InChI | InChI=1S/C15H14N2OS3/c1-3-4-7-20-15-16-13-12(14(18)17(15)2)10(9-21-13)11-6-5-8-19-11/h3,5-6,8-9H,1,4,7H2,2H3 |
| InChIKey | HOJYSEMTZORBBE-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.49 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|