C22H19N3O2S3 — CID 27971648
2-(3-methyl-4-oxo-5-thiophen-2-ylthieno[2,3-d]pyrimidin-2-yl)sulfanyl-N-phenyl-N-prop-2-enylacetamide (PubChem CID 27971648) has the molecular formula C22H19N3O2S3 and a molecular weight of 453.61 g/mol. Its IUPAC name is 2-(3-methyl-4-oxo-5-thiophen-2-ylthieno[2,3-d]pyrimidin-2-yl)sulfanyl-N-phenyl-N-prop-2-enylacetamide.
| Compound Name | 2-(3-methyl-4-oxo-5-thiophen-2-ylthieno[2,3-d]pyrimidin-2-yl)sulfanyl-N-phenyl-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 27971648 |
| Molecular Formula | C22H19N3O2S3 |
| Molecular Weight | 453.61 g/mol |
| Exact Mass | 453.06 |
| IUPAC Name | 2-(3-methyl-4-oxo-5-thiophen-2-ylthieno[2,3-d]pyrimidin-2-yl)sulfanyl-N-phenyl-N-prop-2-enylacetamide |
| SMILES | C=CCN(C(=O)CSc1nc2scc(-c3cccs3)c2c(=O)n1C)c1ccccc1 |
| InChI | InChI=1S/C22H19N3O2S3/c1-3-11-25(15-8-5-4-6-9-15)18(26)14-30-22-23-20-19(21(27)24(22)2)16(13-29-20)17-10-7-12-28-17/h3-10,12-13H,1,11,14H2,2H3 |
| InChIKey | DVCVVEGMYHEPIF-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.61 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|