C22H19N3OS2 — CID 35150549
5-(4-methylphenyl)-3-prop-2-enyl-2-(pyridin-3-ylmethylsulfanyl)thieno[2,3-d]pyrimidin-4-one (PubChem CID 35150549) has the molecular formula C22H19N3OS2 and a molecular weight of 405.55 g/mol. Its IUPAC name is 5-(4-methylphenyl)-3-prop-2-enyl-2-(pyridin-3-ylmethylsulfanyl)thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 5-(4-methylphenyl)-3-prop-2-enyl-2-(pyridin-3-ylmethylsulfanyl)thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 35150549 |
| Molecular Formula | C22H19N3OS2 |
| Molecular Weight | 405.55 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | 5-(4-methylphenyl)-3-prop-2-enyl-2-(pyridin-3-ylmethylsulfanyl)thieno[2,3-d]pyrimidin-4-one |
| SMILES | C=CCn1c(SCc2cccnc2)nc2scc(-c3ccc(C)cc3)c2c1=O |
| InChI | InChI=1S/C22H19N3OS2/c1-3-11-25-21(26)19-18(17-8-6-15(2)7-9-17)14-27-20(19)24-22(25)28-13-16-5-4-10-23-12-16/h3-10,12,14H,1,11,13H2,2H3 |
| InChIKey | PWOMVEBUOGZBFC-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.55 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|