C20H17ClN4OS2 — CID 25468712
2-[(5-chloro-1-methylimidazol-2-yl)methylsulfanyl]-5-phenyl-3-prop-2-enylthieno[2,3-d]pyrimidin-4-one (PubChem CID 25468712) has the molecular formula C20H17ClN4OS2 and a molecular weight of 428.97 g/mol. Its IUPAC name is 2-[(5-chloro-1-methylimidazol-2-yl)methylsulfanyl]-5-phenyl-3-prop-2-enylthieno[2,3-d]pyrimidin-4-one.
| Compound Name | 2-[(5-chloro-1-methylimidazol-2-yl)methylsulfanyl]-5-phenyl-3-prop-2-enylthieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 25468712 |
| Molecular Formula | C20H17ClN4OS2 |
| Molecular Weight | 428.97 g/mol |
| Exact Mass | 428.05 |
| IUPAC Name | 2-[(5-chloro-1-methylimidazol-2-yl)methylsulfanyl]-5-phenyl-3-prop-2-enylthieno[2,3-d]pyrimidin-4-one |
| SMILES | C=CCn1c(SCc2ncc(Cl)n2C)nc2scc(-c3ccccc3)c2c1=O |
| InChI | InChI=1S/C20H17ClN4OS2/c1-3-9-25-19(26)17-14(13-7-5-4-6-8-13)11-27-18(17)23-20(25)28-12-16-22-10-15(21)24(16)2/h3-8,10-11H,1,9,12H2,2H3 |
| InChIKey | IIAPIMPCQGTOCG-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 52.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.97 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|