C28H27N3O4S2 — CID 44640330
propyl 4-[[2-[5-(4-methylphenyl)-4-oxo-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl]sulfanylacetyl]amino]benzoate (PubChem CID 44640330) has the molecular formula C28H27N3O4S2 and a molecular weight of 533.68 g/mol. Its IUPAC name is propyl 4-[[2-[5-(4-methylphenyl)-4-oxo-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl]sulfanylacetyl]amino]benzoate.
| Compound Name | propyl 4-[[2-[5-(4-methylphenyl)-4-oxo-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl]sulfanylacetyl]amino]benzoate |
|---|---|
| PubChem CID | 44640330 |
| Molecular Formula | C28H27N3O4S2 |
| Molecular Weight | 533.68 g/mol |
| Exact Mass | 533.14 |
| IUPAC Name | propyl 4-[[2-[5-(4-methylphenyl)-4-oxo-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl]sulfanylacetyl]amino]benzoate |
| SMILES | C=CCn1c(SCC(=O)Nc2ccc(C(=O)OCCC)cc2)nc2scc(-c3ccc(C)cc3)c2c1=O |
| InChI | InChI=1S/C28H27N3O4S2/c1-4-14-31-26(33)24-22(19-8-6-18(3)7-9-19)16-36-25(24)30-28(31)37-17-23(32)29-21-12-10-20(11-13-21)27(34)35-15-5-2/h4,6-13,16H,1,5,14-15,17H2,2-3H3,(H,29,32) |
| InChIKey | SLEGZKZYVZFSBH-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.68 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|