C25H19N5O2S2 — CID 137266453
(E)-2-(1H-benzimidazol-2-yl)-4-(3-ethyl-4-oxo-5-phenylthieno[2,3-d]pyrimidin-2-yl)sulfanyl-3-hydroxybut-2-enenitrile (PubChem CID 137266453) has the molecular formula C25H19N5O2S2 and a molecular weight of 485.59 g/mol. Its IUPAC name is (E)-2-(1H-benzimidazol-2-yl)-4-(3-ethyl-4-oxo-5-phenylthieno[2,3-d]pyrimidin-2-yl)sulfanyl-3-hydroxybut-2-enenitrile.
| Compound Name | (E)-2-(1H-benzimidazol-2-yl)-4-(3-ethyl-4-oxo-5-phenylthieno[2,3-d]pyrimidin-2-yl)sulfanyl-3-hydroxybut-2-enenitrile |
|---|---|
| PubChem CID | 137266453 |
| Molecular Formula | C25H19N5O2S2 |
| Molecular Weight | 485.59 g/mol |
| Exact Mass | 485.10 |
| IUPAC Name | (E)-2-(1H-benzimidazol-2-yl)-4-(3-ethyl-4-oxo-5-phenylthieno[2,3-d]pyrimidin-2-yl)sulfanyl-3-hydroxybut-2-enenitrile |
| SMILES | CCn1c(SC/C(O)=C(/C#N)c2nc3ccccc3[nH]2)nc2scc(-c3ccccc3)c2c1=O |
| InChI | InChI=1S/C25H19N5O2S2/c1-2-30-24(32)21-17(15-8-4-3-5-9-15)13-33-23(21)29-25(30)34-14-20(31)16(12-26)22-27-18-10-6-7-11-19(18)28-22/h3-11,13,31H,2,14H2,1H3,(H,27,28)/b20-16+ |
| InChIKey | OEZLESWHEBKUTE-CAPFRKAQSA-N |
| XLogP | 5.61 |
| TPSA | 107.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.59 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|