C21H25N3O2S2 — CID 8809719
2-(3-ethyl-4-oxo-5-phenylthieno[2,3-d]pyrimidin-2-yl)sulfanyl-N-pentylacetamide (PubChem CID 8809719) has the molecular formula C21H25N3O2S2 and a molecular weight of 415.58 g/mol. Its IUPAC name is 2-(3-ethyl-4-oxo-5-phenylthieno[2,3-d]pyrimidin-2-yl)sulfanyl-N-pentylacetamide.
| Compound Name | 2-(3-ethyl-4-oxo-5-phenylthieno[2,3-d]pyrimidin-2-yl)sulfanyl-N-pentylacetamide |
|---|---|
| PubChem CID | 8809719 |
| Molecular Formula | C21H25N3O2S2 |
| Molecular Weight | 415.58 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | 2-(3-ethyl-4-oxo-5-phenylthieno[2,3-d]pyrimidin-2-yl)sulfanyl-N-pentylacetamide |
| SMILES | CCCCCNC(=O)CSc1nc2scc(-c3ccccc3)c2c(=O)n1CC |
| InChI | InChI=1S/C21H25N3O2S2/c1-3-5-9-12-22-17(25)14-28-21-23-19-18(20(26)24(21)4-2)16(13-27-19)15-10-7-6-8-11-15/h6-8,10-11,13H,3-5,9,12,14H2,1-2H3,(H,22,25) |
| InChIKey | MRBNNAXECDEREF-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.58 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|